обновление: 2017. 07. 06
не только МИНЕРАЛЫ
А - Б - В - Г - Д - Е - Ж - З - И - К - Л - М - Н - О - П - Р - С - Т - У - Ф - Х - Ц - Ч - ШЩ - Э - Ю - Я

Б

1. Бенитоит. Истоки р. Сан-Бенито, Калифорния, США. 2. Барит. Эльбрусский р-к , Сев. Кавказ, Россия. 3. Берилл. Марианинское м-ние, Забайкалье, Россия. 4. Бразилианит. Минас-Жерайс, Бразилия. ~12 см. 5. Бетафит. Антанифуци, Мадагаскар. 6. Бустамит. Брокен-Хилл, Австралия. Фото: © В. Левицкий и М. Аносов. Образец 1-5: Минер. музей им. А.Е. Ферсмана РАН. Фото 1-5: © А. Евсеев

Местонахождения минералов \ mineral localities на сайте и на страницах справочника Евсеев А.А. Географические названия в минералогии. Краткий указатель. Ч. I, М. , 2000. - 269 с.; Ч. II, М. , 2000. - 282 с.
Часть I и II (выборочно)

М-н-ние
стр.
10-26
26-45
45-54
54
-63
63-73
73-75
75-77
77-80
81-87
87-88
88-122
122-132
132-151
151-160
160-165
166-180
180-188
188-213
213-226
226-234
234-239
239-247
247-249
249-255
255-260
260
260-265
265-267
267-269
Locality
I
N
cтр.
9-24
24-44
44-63
63-71
71-78
78-86
86-96
97-107
108-113
113-118
118-135
135-148
148-172
173-181
181-188
188-203
203
204-214
214-243
243-257
257-260
260-268
268-275
275-276
276-278
278-282

Основные находки минералов

на страницах справочника

Евсеев А.А. Географические названия в минералогии. Краткий указатель. Ч. I, М. , 2000. - 269 с.; Ч. II, М. , 2000. – 282 с.

Часть I и II (выборочно)
Сокращения

*-первоначальное местонахождение (type locality)
!!-превосходные образцы, выдающиеся находки
!!!-одни из самых лучших образцов, самые знаменитые находки
(+)-дополнение к указателю (ГНМ. КУ)
(а)-Северная Америка и Гренландия
(ав)-Австралия и Новая Зеландия
(аз)-Азия (включая Кавказ)
(ан)-Антарктида
(ао)-Атлантический океан
(аф)-Африка
(е)-Европа (включая Урал, Нов. Землю)
(ио)-Индийский океан
(то)-Тихий океан
(юа)-Южная Америка

Бабеффит \\ I. 24(аз)*--Ауник м-ние (Fe-Be), Бурятия, Забайкалье, Россия - Назарова и др. (ДАН СССР, 1966, 167, 93-96) \\ Рожна, Ждяр, Моравия, Чехия 2-ая из двух в mindat.org \\ http://www.mindat.org/loc-5634.html \\ Cempirek J. Hydroxylherderit z Rozne. - Mineral, 2001, roc. 9, c. 5, s. 328-329

Бабингтонит \ Babingtonite. \ http://www.mindat.org/min-478.html \\ I. 22(е)*; 51(а); 78(аз)!!!; 85(аз); 126(а); 158(аз)!!; 170(е); 234(а)!!; II. 21(е)*; 126(аз); 138(а)!!; 271(а)!!--Масс.—xls<3, 5 см; минерал назван в честь Уильяма Бабингтона \ Dr. William Babbington (1757-1833), ирландского врача и минералога.

Бабкинит \\ I. 154(аз)*

Бавенит \\ I. 26(е)*!!; 46(е)!!; 58(аз); 71(аз); 74(аз)!!; 91(аз); 232(аз); II. 29(е)*; 68(аз)!; 158(а); 260 \\ Изумрудные копи \\ Забайкалье

Багдадит \\ 70(аз)*

Бадделеит \\ I. 27(аз); 107(е); 166(аф)!!!; 180(аф)!!; II. 189(аф)!!!; 205(аз)*; 227(юа); 236(аз)* \\ http://www.mindat.org/min-480.html \\ * Kollonnagam, Rakwana, Sabaragamuwa Province, Sri Lanka - http://www.mindat.org/loc-3144.html

Бадделеит \ Baddeleyite. [Палаборва, Лимпопо пров. \ Phalaborwa, Limpopo Province], ЮАР. Кристаллы до 6 мм. Образец: Минер. музей РГГРУ (Р-1387) . Фото: © А.А. Евсеев. \\ ср. фото mindat

Баддингтонит \\ 242(а)*

Баженовит \\ I. 111(е)*

Базы данных_минералогические \\ http://www.mindat.org/ \\ http://www.mineralcollecting.org/data/index.shtml -- http://www.mineralcollecting.org/data/allcategory.cgi \\ Указатель - http://www.mineralatlas.com/General%20introduction/frames%20general%20descriptions%20alphabetical.htm (огр. кол-во фото)

Базалюминит \\ I. 175(е);

“Базаномелан” (= ильменит) \\ II. 239(е)!!

Баиянит \\ II. 227(юа)*

Байерит \\ I. 242(аз)*; II. 99(аз)*

“Байкалит” (= диопсид) \\ I. 229(аз)!!

Байлдонит \\ I. 90(аз); II. 255(аф)—Цумеб;

Байянит \\ II. 190(юа)

Бакерит \\ I. 250(а); II. 85(а)*

Баксанит \\ I. 27(аз)*; 226(аз)* \\ Пеков И.В., Завьялов Е.Н., Федющенко С.В., Щербачев Д.К., Бородаев Ю.С., Дорохова Г.И. Баксанит Bi 6 (Te 2 S 3 ) - новый минерал из Тырныауза (Северный Кавказ) // Докл.РАН, 1996, 347, 6, 787-791.

[Бакхорнит] (buckhornite) \\ II. 42(а)*

Балифолит \\ I. 213(аз)*; II. 105(аз)*; 275(аз)*--Сянхуалин, Хунань

Балканит \\ I. 198(е)*; II. 226(е)*

Балякинит \\ I. 10(аз)*; 173(аз)* \\ Агинское м-ние*, Камчатка; Пионерское м-ние*, Вост. Саян, Россия; Сальм-Шато, Ставло м-в, Бельгия - http://www.mindat.org/loc-278.html

Бамболлаит \\ II. 27(а)*; 135(а)*

Бамфордит \\ II. 27(ав)*

Банальсит \\ II. 31(е)*

Бандилит \\ I. 102(юа)*; II. 203(юа)*

Баотит \\ I. 30(аз)*; 180(а); 252(е) \\ Баюнь-Обо = Баян-Обо \ Bayan-Obo, м-ние (Fe-TR-Nb), Баотоу, Внутр. Монголия, Китай\\ Гордон-Бьютт, округ Мар, Монтана, США \ Gordon Butte, Meagher Co., Montana, USA -

--Е. И. СЕМЕНОВ, ХУН ВЕН-СИН и Т. А. КАПИТОНОВА. О НОВОМ НИОБИЕВОМ МИНЕРАЛЕ БАОТИТЕ. - ДАН СССР, т.136, №4, 915-916 \\ читать - http://rruff.info/uploads/DANS136_915.pdf

Баотит (черно-бурые кристаллы) в кварце с пол. шпатом. Баюнь-Обо, Внутр. Монголия, Китай. Образец: Мин. музей им.А.Е. Ферсмана РАН (Колл. В.И. Степанова. ST3293. Семенов Е.И., Хун Вен-син, Капитонова Т.А., 1961)/ Фото: © А.А. Евсеев.

Барарит \\ II. 27(аз)* \\ http://www.mindat.org/min-511.html \\ Zacek, V., Ondrus, P.: Mineralogy of recently formed sublimates from Katerina colliery in Radvanice, Eastern Bohemia, Czech Republic. - Bulletin of the Czech geological survey, 1998, vol. 73, no. 2, s. 289-302.

Баратовит \\ I. 64(аз)*

Барбертонит \\ I. 28(аф)*; II. 28(аф)*; 70(ав)

Барбосалит \\ I. 13(аз); 19(аф); 194(юа)*; II. 18(аф); 222(юа)*;

Баренцит \\ I. 184(е)*

Бариандит \\ I. 149(аф)*; II. 168(аф)*

Барилит \\ I. 104(е); 126(а)!!; 168(а)!!; 182(е); 260(е); II. 62(а)!!--xls<5 см; 109(а); 137(а)!--Колорадо; 138(е)*--Лонгбан; 196(а)!!--Пайкс-Пик; 225(а)—Лабрадор; \\ http://www.mindat.org/min-545.html \\ фото (22) - в т.ч. - Верх. Эспе--фото - http://www.mindat.org/photo-205861.html ; Логбан!; Дара-и-Пиоз Дараи-Пиёз м-в-- Паутов Л.А. и др. (до 2009 г.) ; Маунт-Малоса, Малави--кр-лы до 2 см ; \\ Demartin, F.; Guastoni, A. & Pezzotta, F. (2003): Barylith, Niobophyllit & yttriumreicher Milarit - Neufunde aus den Pegmatiten von Zomba-Malosa, Malawi. - Lapis 28 (1), 18-21 (in German).

Бариомикролит \\ I. 191(юа)*; II. 53(юа)*

Бариоольгит* \\ Палитра* пегматит, Кедыкверпахк г., Ловозеро, Кольский п-ов, Россия --Пеков И.В., Чуканов Н.В., Куликова И.М., Зубкова Н.В., Кротова О.Д., Сорокина Н.И., Пущаровский Д.Ю. Новый минерал бариоольгит Ba(Na,Sr,REE)2Na[PO4]2 и его кристаллическая структура // ЗВМО, 2004, 133, 1, 41-49. \\

Бариопирохлор \\ I. 167(аф)*; II. 190(аф)*--Танзания; \\ Бариопирохлор ("пандаит") \\ http://www.mindat.org/min-527.html \\ фото (2) - Кукисвумчорр

Бариофармакосидерит \\ II. 56(е)*

Бариоферрит \\ Мурашко М. Н., Чуканов Н. В., Муханова А. А., Вапник Е., Бритвин С. Н., Кривовичев С. В., Полеховский Ю. С., Ивакин Ю.Д. Бариоферрит BaFe3+12O19-новый минерал группы магнетоплюмбита из формации Хатрурим (Израиль). - ЗРМО, 2010, ч. 139, вып. 3, с. 22-30.

Барисилит \\ I. 241(е)*; II. 83(а); 99(е)*; 129(аф)

Барит - фотогалерея \\ I. 10(аз); 16(е)!!; 23(аз); 29(е); 29(аз)!!); 30(е)!!!; 32(аз)!!; 33(е); 39(аз); 56(аф); 61(аз); 62(аз)!!; 63(е)!!; 65(е)!!!; 67(аз)!!; 69(аз); 88(е)!!; 89(аз)!!; 93(аз); 95(аз); 97(аз); 97(аф); 102(е); 104(е); 115(е); 134(аз); 137(аз)!!; 138(аф); 139(е)!!; 145(аз); 157(е); 158(а)!!; 159(е)!!; 162(е); 168(аз)!!; 168(е)!!; 172(е); 172(е)!!; 175(е)!!; 176(е); 186(а); 209(а)!!!; 212(аз); 216(аф); 219(аз); 226(аз)!!; 230(е); 233(аз)!!; 233(е)!!; 237(е)!!; 238(е)!!!; 240(аз); 240(аф); 246(а); 251(аз)!!; 254(е); 256(аф); 261(е)!!!; 262(аз)!!; 268(е);

II. 25(е)!!!; 28(а)!!; 49(е)!!; 51(е)!!; 56(е)!!; 60(е)!!; 64(е)!!; 66(а)!!; 69(е)!!!; 74(а)!!; 74(а)!!; 83(е)!!; 84(е)!!!; 91(е)!!; 98(е)!!; 98(аф)!!; 156(а)!!; 159(аф)—Марокко ; 162(е)!!--Камбрия; 170(е)!!!--(Эгремонт); 171(аф)!!; 179(а)!!!--“розы”; 179(а)!!--“розы”; 188(а)!!; 188(е)!--...Болонья; 191(е)!!; 198(е)!!--Пёла; ; 201(е)!!; 211(а)!!--Невада; 228(аф)!!; 237(е)!!; 240(а)!!--Стонем, Колорадо—xls<22 см; 241(е)!!--Сард. ; 270(аф)—xls<16 см

1. Барит с включениями песка ("роза"). Норман, округ Кливленд, Оклахома, США. Образец: Минералогический музей МГРИ-РГГРУ (№№1952, дар: ФМ). 8 см. 2. Барит. Эльбрусский р-к , Сев. Кавказ, Россия. 4,5х4,5 см. Мин. музей им. А.Е. Ферсмана РАН (Колл.: В.И. Степанов, сбор 1973 г.). Фото 1-2: © А.А. Евсеев.

Барит, Pb-сод. (“хокутолит”) \\ II. 104(аз)

Баритокальцит \\ I. 16(е)*!!; 104(е)!!; II. 15(е)*; 35(е)*

Баритолампрофиллит \\ I. 182(е); II. 257(е)

Баричит \\ II. 33(а)*; 36(а)*; 153(ав); 205(а)*--Рапид-Крик, Юкон; \\ http://www.mindat.org/min-524.html \\ 1) Юкон* 2) Marlborough , South Island , New Zealand; 41°50'S , 173°40'E - http://www.mindat.org/loc-15427.html \\

Баркевикит \\ I. 163(аз); II. 140(е); 245(аф)--...Лос;

Баркильит (barquillite) \\ II. 28(е)*

Барнесит \\ II. 198(а)

Барсановит"" \\ Дорфман М.Д. и др., 1963 (ДАН СССР, 1963, 153, 5) \\ см. георгбарсановит ( Хомяков А.П., Нечелюстов Г.Н., Екименкова И.А., Расцветаева Р.К. Георгбарсановит, Na12(Mn,Sr,REE)3Ca6Fe2+3Zr3NbSi25O76Cl2·H2O-минеральный вид группы эвдиалита: реабилитация барсановита и новое название минерала. - Зап. РМО, 2005, ч.134, вып. 6, с. 47-56.\\ Подробнее - http://www.mindat.org/min-33389.html \\ http://www.mindat.org/min-27506.html)

--Хомяков А.П., Нечелюстов Г.Н., Екименкова И.А., Расцветаева Р.К. Георгбарсановит, Na12(Mn,Sr,REE)3Ca6Fe2+3Zr3NbSi25O76Cl2*H2O - минеральный вид группы эвдиалита: реабилитация барсановита и новое название минерала. - ЗРМО, 2005, Часть 134, Выпуск 6, с. 47-57 \\

--Утверждён 2003.
Первоначально описан как моноклинный минерал под названием Барсановит, дискредитированный IMA в 1969 г.; в 2003 г. утверждён IMA как новый тригональный минеральный вид под названием Георгбарсановит.

--Хомяков А.П., Расцветаева Р.К (2005): Каким образом мы потеряли Барсановит и выиграли Георгбарсановит. - Природа, (12), с. 25-28

Барстоуит \\ II. 39(е)*

Бартит \\ II. 96(аф)

Бартонит \\ II. 61(аз)* \\ * Койот-Пик, 16 миль к ЮЗ от Орик, округ Гумбольдт, Калифорния, США \ Coyote Peak diatreme, 16 miles SW of Orick, Humboldt Co. California. \\ http://webmineral.com/data/Bartonite.shtml \\ Невада, США - Lunar Craters, Nye Co., Nevada, USA \ Volcanic field -- http://www.mindat.org/min-544.html \ http://www.mindat.org/loc-62063.html \\ Палитра пегм., Ловозеро, Россия-- Пеков И.В., Щербачев Д.К., Кононкова Н.Н. Бартонит из Ловозерского массива (Кольский полуостров). - ЗВМО, 2003, 132, 3, 97-101. \\ http://www.mindat.org/min-544.html

Бассанит \\ I. 47(е)!!

Бассетит \\ II. 28(е)

Бастнезит \\ I. 14(аз); 30(аз); 59(аз); 73(аз); 81(е); 87(аф); 131(е)!!; 222(аф); 240(аз); II. 17(аф)!!; 148(е)!!--Лузенак, Фр.--xl 2, 8 см; 185(ав); 240(а)—Квебек; 252(аф)—Мадаг. \\ Белая Зима - http://www.mindat.org/loc-19421.html

Бастнезит-(La) \\ I. 31(аз) \\ http://www.mindat.org/min-561.html

Бастнезит-(Ce) \ \ Bastnasite-(Ce) \\ I. 29(е)*; II. 29(е)*; 168(а); 254(е)!!--Арьеж—xls \\ http://www.mindat.org/min-560.html

Бастнезит-(Y) \\ I. 48(аз) \\ http://www.mindat.org/min-562.html

Батисивит* \\ Резницкий Л. З., Скляров Е. В., Армбрустер Т., Галускин Е. В., Ущаповская З. Ф., Полехоский Ю. С., Карманов Н. С., Кашаев А. А., Бараш И. Г. Батисивит V8Ti6[Ba(Si2O)]O28-новый минеральный вид из группы дербилита. - Зап. РМО, 2007, ч.136, вып. 5, с. 65-75 [Слюдянский комплекс]

Батисит \\ I. 84(аз)*; II. 257(е)

Батиферрит\ batiferrite \\ запад. часть обл. Эйфель, Германия--Lengauer C.R. et al., 2001; ЗВМО, 2002, №6, 24-25

Бауит (bowieite) \\ II. 216(а)*

Баураноит \\ I. 162(аз)*; 209(аз)*

Бафертисит \\ I. 30(аз)*; 48(аз); II. 29(аз)* \\ Верхнее Эспе!@—Яковлевская Т.А., 1965л; 140-C; ФМ (№66217, Минеев Д.А., 1964) \\ Дара-Пиоз, Тадж.-- mdt

Бафертисит (геовики) \\ Лыкова И. С., Пеков И. В., Кононкова Н. Н., Шпаченко А. К. Цзиньшацзянит и бафертисит из щелочного комплекса Гремяха-Вырмес (Кольский полуостров). - ЗРМО, 2010, ч. 139, вып. 2, стр.73-79

Бахчисасарайцевит\ bakhchisaraitsevite \\ Ковдорский Ковдорский м-в, Кольский п-ов, Россия--Liferovich R.P. et al., 2000; ЗВМО, 2002, №6, 27-28 \\ Железный р-к, Ковдор, Кольский п-ов. Кристаллы до 5-7 мм--фото--http://www.mineralogist.ru/

Бацирит \\ I. 186(ао)*; II. 210(ао)*(е)* \\ известен в пяти странах - Великобритания; Таджикистан; Монголия; США; Мексика \\ Bazirite , Ba Zr Si3 O9, a new mineral from Rockall Island, Inverness-shire, Scotland, Mineral. Mag., G.B., 1978, 42, 35-40 \\ http://www.mindat.org/min-585.html \\ Дара-и-Пиоз - Паутов Л.А., Хворов П.В. Бацирит из Таджикистана. - ЗВМО, 1998, т. 127, №1, с. 80-83

Баццит \\ I. 26(е)*; 102(аз)!!; 125(е); II. 29(е)*; 85(е); 168(а)—Колорадо; 240(е); 262(е); 274(е)—Швейц. \\ Чистякова М.Б. и др. Первая находка баццита в СССР. - ДАН СССР, 1966, т. 169, №6, 1421 - [Кент, Казахстан]

Баццит, Cs-вый \\ I. 218(е)

Баянханит \\ I. 81(аз)*

Беарсит \\ I. 40(аз)* \\ Бота-Бурум м-ние*, Казахстан \\ Копченова В.Е., Сидоренко Г.А. Беарсит - мышьяковый аналог мораэсита. - ЗВМО, ч. 94. в. 4, стр. 442-446.

Беартит \\ I. 72(е)*; II. 68(е)*; 165(е)*

Безсмертновит \\ I. 10(аз)*;

Бейделлит \\ I. 246(аз)

Бейерит \\ I. 84(аз)

Бейлиит \\ II. 102(а)*

Беккерелит \\ I. 99(аф); 258(аф)*; II. 123(аф)*; 229(аф)*!!

Беллидоит \\ II. 97(е)

Беловит-(Ce) \\ I. 16(а); 104(е); 136(е)* \\ Пеков И.В., Чуканов Н.В., Елецкая О.В., Хомяков А.П., Меньшиков Ю.П. Беловит-(Се): новые данные, уточненная формула и соотношение с другими минералами группы апатита. - ЗВМО, 1995, 124, 2, 98-110.

Беловит-(La) \\ I. 230(е) \\ Пеков И.В., Куликова И.М., Кабалов Ю.К., Елецкая О.В., Чуканов Н.В., Меньшиков Ю.П., Хомяков А.П. Беловит-(La) Sr3Na(La,Ce)[PO4]3(F,OH) - новый редкоземельный минерал из группы апатита. - ЗВМО, 1996, 125, 3, 101-109.

Беломорит (= олигоклаз, иризирующий) \\ I. 54(е); 103(е); 175(е)!!; 203(е)!!; 204(е)!!; 243(е)!!; 255(е)!!

“Беломорские рогульки” (пс-зы кальцита по икаиту) \\ I. 162(е)!!

Беломорский комплекc \\ Володичев О.И. Беломорский комплекс Карелии. Л.: Наука. 1990. 245 с.

Белоречит (розовый кварцит) \\ I. 32(аз)

Белоруссит \\ I. 70(е)* \\ Шпанов Е.П., Нечелюстов Г.М., Батурин С.В., Солнцева Л.С. Белоруссит -(Ce) - NaMnBa2Ti2Si8O26(F,OH)·H2O - новый минерал группы джоакинита. - ЗВМО, 1989, 118, №5, 100-107

Белый камень \\ Л.И.Звягинцев, А.М.Викторов. Белый камень Подмосковья. М., 1989.

Бельковит \\ I. 54(е)* \\ Волошин А.В., Субботин В.В., Пахомовский Я.А. и др. Бельковит - новый минерал из карбонатитов массива Вуориярви (Кольский полуостров). - ДАН СССР, 1990, т. 315, №5.

Белянкинит \\ I. 226(е)*

Бементит \\ I. 233(аз); II. 83(а)*

Бенавидесит \\ I. 65(аз); 233(юа)*; II. 257(юа)*--Перу;

Бендадаит - http://www.mindat.org/min-31722.html \\ Вета Негра \ Veta Negra, Атакама, Чили. Образец: ФМ (№92502. Farber, Gunnar. 2008).

Бенжаминит \\ I. 11(аз); II. 188(а)*

Бенитоит \\ I. 32(а)*!!!; 63(а)!!; 163(аз); 190(а)!!!; II. 31(а)!!!; 64(а)!!!; 183(аз); 188(е)—Бельгия—в песках; подробнее: http://www.benitoitemine.com/benitoite/jvcollection.shtml \\ Louderback, G.D. & W.C. Blasdale (1907), Benitoite, a new California gem mineral, with chemical analysis by Walter C. Blasdale, University of California, Department of Geological Science Bull.: 5: 149-153.

Бенитоит. Истоки р. Сан-Бенито, Калифорния, США. Кристаллы до 1,5 см. Образец: ФМ. Фото: © А.А. Евсеев.

Бенлеонардит \\ II. 135(а)*

Бенстонит \\ I. 69(аз); 101(а)!!; II. 49(а)!!; 150(а)*--Арканзас;

Бераунит \\ II. 105(е)*; 143(е)

Бербанкит = бурбанкит (см.) \ burbankite \\ Беловицкая Ю.В., Пеков И.В. Генетическая минералогия группы бербанкита // Тр. Минер. музея РАН (Новые данные о минералах), 2004, 39, 51-65. \\ Пеков И.В., Беловицкая Ю.В. Минералы семейства бербанкита из карбонатитовых и агпаитовых массивов: сравнительная характеристика. - Карбонатиты Кольского полуострова. СПб., 1999, 89-91.

Берборит \\ I. 132(е)*; 173(е)*

Берборит-2H \\ II. 214(е)*

Берборит-2T \\ II. 214(е)*

Бергенит \\ II. 32(е)*

Бердесинскиит \ berdesinskiite* \\ II. 139(аф)* \\ Ласамба-Хилл* , Квале (р-н), Кения \\ Ольхонские Ворота. пролив и Перевал к-р \\ http://www.mindat.org/min-630.html \\

Березанскит \\ I. 64(аз)*

Берилл \\ I. 11(аз)!!; 14(аз); 17(аз); 18(е)!!; 18(аф)!!; 20(аф)!!; 22(юа); 27(аз); 28(а); 29(аз); 31(аз); 35(аз); 36(аф); 37(е); 37(а); 40(аз)!!; 52(е)!!!; 57(аф); 59(аз); 65(аф); 66(аз); 67(аф); 70(аз); 72(аз); 85(аз)!!; 96(аз); 105(а)!!; 107(аф)!!; 107(аз)!!; 118(аз); 120(аз); 122(аз); 123(юа)!!; 128(е); 129(а); 135(аф)!!!-xl 18 м; 136(аз); 141(аф); 144(юа); 144(юа)!!!; 145(е)!!!; 147(е); 150(е)!!!; 152(аф); 157(аз); 164(аз); 165(аз); 172(юа)!!; 176(е)!!; 178(аз); 181(аз)!!; 189(аз)!!; 192(е); 196(аз); 196(е)!!; 198(е); 201(аф); 203(аз)!!; 205(аз); 208(е)!!; 212(аз); 217(аз); 219(аз)!!; 231(аз); 246(аз); 258(аф); 259(аф); 266(аз);

II. 12(а)!!--xl 5 м; 15(аф)!!; 99(а)!!!; 104(аз)!!; 125(а)!!!--xls<9 м; 128(аф)!-д. к. ; 129(аф)!!; 148(е)—д. к. ; 150(аф)!!!--Малакиалина—xl 18 м; 195(юа)!!!--Браз. –xls<200 т; 199(е)!!--...Леон, Исп. --круп. xls; 255(а)!!--Мадаг. ;

1. Берилл. Марианинское м-ние, Забайкалье, Россия. (поступление 1955 г.). 2. Берилл красный ("биксбит") в риолите. Уа-Уа Маунтинс\ Wah Wah Mts, Юта, США. Кристалл ~3 см.(№№81692, 84849. Barlow F.J., 1982. Обмен, 1986). Образец 1-2: ФМ. Фото 1-2: © А.А. Евсеев.

Берилл. Старцева яма, Мурзинка, Ср. Урал, Россия. 25 см. Образец: Горный музей. Источник: Ферсман А.Е. Занимательная минералогия. М. - Л.: "Детская литература", 1937. - 240 с. (фото - с. 128-129). – фото

Берилл- специальный выпуск журнала ExtraLapis English: Beryl and its Color Varieties
by (editors) Alexander Falster, Miranda Jarnot, Gunther Neumeier, William “Skip” Simmons, Gloria Staebler, Tom Wilson and Michael Wise. Подробнее: http://www.minrec.org/bookdetail.asp?id=36

Берилл!!!-- рекордный кристалл длиной 18 м, диаметром 3,5 м, объемом 143 куб м и весом 379,5 т был найден в пегматитах в 1960-ые гг. на р-ке А-4 в районе Малакалина\ Malakialina на Мадагаскаре (Rickwood P.C., 1981; Dana, 1997)

Берилл!!--кристалл высотой 2,3 м--рекорд для Евразии? \\ Кара-Су уч-к, р-к Шара-Суме, Монг. Алтай, Синьцзян, Китай-находка огромного кристалла высотой 2,3 м при поперечном сечении 40х65 см. во время пребывания на р-ке А.А. Беуса [1952 г.] Ярмолюк В.А. и др., 1997, с.117
Ярмолюк В.А. , Коляжнов А.А. Советские геологи за рубежом. (Международная деятельность геологической службы СССР). 1931-1991. М.: "Лориен", 1997. - 278 с.

Берилл!! \\ Олбани, Мэн, США--гигантский кристалл берилла \\ Gedney E. K. and Berman H. Huge beryl crystals at Albany, Maine. - Rocks and Minerals, 1929, v. 4, no. 3, p. 78-79.

Берилл, оранжевый \\ I. 166(юа)!!!

Берилл розовый \\ I. 151(аф); II. 161(юа)!!!--Мин.-Жер. –xls<60 см;

Берилл синий \\ II. 20(юа)!!

Берилл малиново-красный \\ I. 50(а)!!!; 221(а)!!!; 227(а)!!!; 241(а)!!!; II. 249(а)!!!--Юта; 266(а)!!!; 268(а)!!!

Берилл, Cs-вый \\ I. 241(е)

Бериллий_минералы бериллия \\ Пеков И.В. Замечательные находки минералов бериллия от Кольского п-ова до Приморья \ Pekov I.V. Remarkable finds of minerals of beryllium from Kola peninsula to Primorie // World of Stones, 1994, 4, 10-26. \\ Беус А.А. Геохимия бериллия и генетические типы бериллиевых месторождений. М.: Изд-во АН СССР, 1960. -329 с. \\

Бериллий \\ Grew, E.S. (2002): Mineralogy, petrology and geochemistry of Beryllium: an introduction and list of Beryllium minerals. I “Beryllium: mineralogy, petrology and geochemistry” in: E.S. Grew (editor). Miner. Soc. Amer. Reviews in mineralogy and geochemistry, Vol. 50, 1-76.

Бериллит \\ I. 98(е)* \\ http://www.mindat.org/min-643.html \\ фото

Бериллонит \\ I. 50(е); 155(аз)!!; 168(аз)!!; 209(а)!!; II. 190(аз)!!--Афг. ; 240(а)*--Мэн;

Берлинит \\ I. 245(е); II. 264(е)*; 271(е)*--Шв. ;

Берманит \\ II. 25(а)

Бернардит \\ II. 15(е)*

Берндтит \\ http://www.mindat.org/min-637.html

Берндтит-2Т \\ II. 50(юа)*

Берндтит-4H \\ II. 189(е)*

Берриит \\ I. 216(аз); II. 246(аз)

Бертоссаит \\ II. 43(аф)*

Бертрандит \\ I. 11(аз); 24(аз); 53(аз)!!!; 58(юа); 75(аз)!!; 85(аз); 96(аз)!!!; 110(юа); 113((аз)!!!; 113(аз); 113(аз); 126(а); 158(аз); 173(е); 194(аз); 197(аз); 207(а); 219(аз); 221(аз)!!; 249(аз); 259(аф); II. 59(юа)!!; 76(юа)!; 168(а)—Колорадо; 244(аз)—Ю. Корея; 252(аз); 271(а)!!--Мэн;

Бертьерит \\ I. 22(аз); 80(аз); 181(аз); 189(аз); 195(аз); 228(аз); 243(е)!!; II. 101(е)!! \\ Клемперт С.Я. О бертьерите из Карамазара. - Науч. тр. Ташкент. у-та, 1964, в. 234, с. 109-113. (Пайбулак, Сев. Таджикистан)

Берцелианит \\ II. 42(е); 97(е)!!; 232(е)*; 282(е)--Гарц

Берцелиит \\ I. 130(е); II. 138(е)*

Бета-керолит \\ I. 250(е)

Бетафит \\ I. 21(аф); 28(а)!!; 34(аф)*!!; 133(аф)!!; 173(аз)!!; 174(аз); 222(аф); II. 16(аф)!!!; 32(аф)*!!--xls<30 кг; 37(аф)!; 231(а)!!--...Банкрофт;

1. Бетафит. Антанифуци\ Antanifotsy, Мадагаскар. (№25052, Lacroix A., 1925). 2. Бетехтинит. Джезказган, Казахстан. Длина игольчатых кристаллов ~5-6 см. (№77272, Слётов В.А., 1976). Образец 1-2: ФМ. Фото 1-2: © А.А. Евсеев.

Бетехтинит \\ I. 68(аз)!!!; II. 42(аз); 44(а); 129(аф); 137(юа); 152(е)*--Мансфельд; 171(е); 277(аз); \\ http://www.mindat.org/min-650.html (2009.01.10): более 20 м-н-ний в 14 странах, но 12 фото всего из двух (11-Джезказган, Казахстан; 1-Бьютт, Монтана, США) \\ A. Schuller & E. Wohlmann (1955): Betechtinit, ein neues Blei-Kupfer-Sulfid aus dem Mansfelder Rucken.- Geologie 4, 535-555.
Бетпакдалит (новый класс минер., по В.И.Степанову) \\ I. 96(аз)* \\ Караоба м-ние (Джамбул пос.)*(1961)—144-F; 145-19; ФМ (62532, Ермилова Л.П., 1961) \\ WITZKE, T. & MUNCH, U. (1991): Betpakdalit von Sadisdorf.- Lapis 16(11), 27-28

Беусит \\ I. 122(аз); 130(юа)*; II. 146(юа)* \\ Кырк-Булак, Туркестанский хр., Киргизия. Образец: ФМ (№57458. Гинзбург А.И., 1955).

Бехиерит \\ I. 21(аф)!!; 137(аф)*; II. 152(аф)*--Мадаг. ;

Бехиерит* - http://www.mindat.org/min-602.html \\ Манжака*, Мадагаскар -- Mrose M.E. & Rose jr, J. (1961): Behierite, (Ta, Nb)BO4, a new mineral from Manjaka, Madagascar. - Geol.Soc.Am., Abstracts 1961 Ann. Meetings, p 111A \\ Пайн-Ривер пегматит, Ферн, округ Флоренс, Висконсин, США \ Pine River pegmatite locality, Fern , Florence Co. , Wisconsin , USA - 2-ая нах. бехиерита в мире (из двух в миндат)--реф.: Rocks & Min. (2002) 77:170

Бехоит \\ I. 173(е); 186(а)*; 199(а); II. 210(а)*--Техас;

Бёггильдит \\ II. 113(а)*

Бёдантит \\ I. 33(аз); 91(е); 96(аз); 178(е); 223(аз); II. 104(е)*; 146(е)*

Бёдантит!! \\ Зап. Каптархана, Такелийское руд. поле, Карамазар—главный руд. мин. в зоне окисления-- МУ-II, 232

Бёркеит \\ II. 225(а)*

Бёрнессит \\ II. 180(аф)

Бианкит \ Bianchite - http://www.mindat.org/min-660.html \\ II. 37(е) \\

Биберит \\ I. 34(е)*; II. 33(е)*

Библиотеки \\ http://www.rvb.ru \\ Российская национальная библиотека (Садовая, 18) \ http://www.nlr.ru:8101/ \\ библиотеки мира - http://thenonist.com/index.php/thenonist/permalink/hot_library_smut/

Биверит \\ II. 105(а)*

Бигкрикит\ bigcreekite \\ Биг-Крик и Раш-Крик м-ния, округ Фресно, Калифорния, США--Basciano L.C. et al., 2001; ЗВМО, 2002, №6, 30

Бидоит \\ II. 151(а)*

Бикитаит \\ I. 35(аф)*; II. 34(аф)*

Биксбиит \\ I. 221(а)!!!; 229(е); II. 145(аф)!; 200(аф); 231(а)*--Юта; 249(а)*!!!--Юта—xls<2, 5 см; 251(аз)—Индия; 252(а)!!--Юта;

Билибинскит \\ I. 10(аз)*; 266(аз)*

Билинит \\ II. 34(е)*

Бильетит \\ I. 258(аф)*

Биндгеймит \\ I. 15(аз); 79(аз); 155(аз)*; 156(аз); 223(аз); II. 230(аф)—Тунис;

Биоминералогия \\ Кораго А.А. Введение в биоминералогию. Л.: Недра, 1992. 280 с.

Биотит \\ I. 51(е); 65(а)!!; 222(а)!!!; 261(е)!!!; II. 252(а)!!--xls<6x2,5 м--Мэн; \\ Кориневскй В. Г., Кориневский Е. В., Кориневская Г. Г. Бариевый биотит из Ильмен). - Зап. РМО, 2005, 134, № 2, с.75-83

Биотит. Риколатва, Кольский п-ов, Россия. Более 20 см. Образец: Минер. музей РГГРУ (Р-300. Дар: И.В. Пеков, 2008). Фото: © А.А. Евсеев. [Первое фото минерала на сайте] |

 

Бираит-(Ce)* - новый минерал из Сибири, представитель нового структурного типа \\ Бирая руд-ние*, 150 км к В от Бодайбо,Иркутская обл., Россия \ Konev A.; Pasero M.; Pushcharovksy D.; Merlino S.; Kashaev A.; Suvorova L.; Ushchapovskaya Z.; Nartova N.; Lebedeva Y.; Chukanov N.Biraite-(Ce), Ce2 Fe (CO3) (Si2O 7 ), a new mineral from Siberia with a novel structure type \ European Journal of Mineralogy, Volume 17, Issue 5, 2005, Pages 715-721

Бирюза \\ I. 14(аз); 16(аз); 21(а); 24(аз)!!; 25(а)!!!; 26(аз); 35(аз)!!; 36(а)!!--xls; 45(аф)!!; 50(а); 53(аз)-Китай; 64(аз); 76(аз)!!; 112(а)!!; 119(аф); 128(а)!!-xls; 133(аз); 156(аз)!!!; 210(аф); 216(аз); 219(аз); 242(е); 246(аз)!!;

II. 9(аз)!!!; 35(а)—xl<2 мм; 63(а)—пс-зы по апатиту; 64(аз)!; 92(аф); 93(ав); 97(а)!!!--монолит 50 кг; 102(а)!!; 106(аз)!!; 123(аф); 127(а)!!; 130(аф)!; 146(а)!!; 148(а)!!--xls; 149(аз)!!; 178(аз)!!!--Иран; 220(а)!!--Нью-Мексико; 274(аз)—Хубэй; \\ Менчинская Т. И. Бирюза. М. , Недра, 1981, 159 с. \\ ExtraLapis, No.16, 1999

Бирюза в изменённой породе. Техутское м-ние, Армения . Фрагмент образца ~12х10 см. Минералогический музей РГГРУ (№640). Фото: © А.А. Евсеев.

 

Бирюза_находки кристаллов (микро) \\ обзор местонахождений по всему миру - http://www.element51.com/article1.htm \\ Бирюза - ExtraLapis, No.16, 1999

Бисмит - http://www.mindat.org/min-687.html

Бисмоклит \\ I. 96(аз); II. 44(ав); 238(аф)*

Бисмоклит! @ \\ Караоба м-ние (Джамбул пос.) @—144-F; 145-19; ФМ (№53768, Степанов В.И., 1952); М-2-1, 180

Бисмутит\ Bismutite \\ I. 158(аз); 257(аз); II. 258(е)*\\ http://www.mindat.org/min-687.html

Бисмутоколумбит \\ I. 64(аз)*; 135(аз)*

Бисмутомикролит \\ II. 269(аф)*

Бисмутотанталит \\ I. 16(аф); 55(аф)*; 107(аз); 152(аф); 190(юа); II. 86(аф)*; 214(юа)!

Биссолит (= актинолит) \\ I. 65(аз); 106(е)

Бистромит \\ II. 136(а)*

Битиит \\ I. 36(аф)*; 140(аф)*; 264(е); II. 35(аф)*; 99(а); 145(ав); 150(аф)*; 215(аф);

Битиклеит [bitikleite, IMA2009-052, старое название – bitikleite-(SnAl)], Ca3SnSbAl3O12, гора Лакарги, Верхнечегемская кальдера, Северный Кавказ \\ Galuskina, I.O., Galuskin, E.V., Armbruster, T., Lazic, B., Dzierzanowski, P., Gazeev, V.M., Prusik, K., Pertsev, N.N., Winiarski, A., Zadov, A.E., Wrzalik, R., and Gurbanov, A.G. (2010) Bitikleite-(SnAl) and bitikleite-(ZrFe)—new garnets from xenoliths of the Upper Chegem volcanic structure, Kabardino-Balkaria, Northern Caucasus, Russia. American Mineralogist, 95, 959–967.

 

Для сравнения два граната. Слева - битиклеит (безкремниевый гранат - Ca3SbZrAl3O12,  открытый Ириной Галускиной в 2009 году на Лакарги), размер кристалла 20 микрон.  Справа - гроссуляр с Вилюйского месторождения, один из  самых "старых" гранатов, известный с 1790 год. Фото и текст : © Е.В. Галускин.

 

Битовнит \\ I. 126(а); 165(а)*; II. 44(а)*; 137(а)!; 187(а)*--Онтарио

Бифосфаммит \\ II. 95(юа)*; 171(ав)

Бифосфаммит. Мурра-эль-Элевин пещ.\ Murra-el-Elevyn Cave, Зап. Австралия. Образец: ФМ (Гарске Д., 1979). 2. Бобьерит. Ковдор, Кольский п-ов, Россия. Фрагмент 7х5 см, xls<2 см. Образец: ФМ (№86598, Бритвин С., 1989. Фото 1-2: © А.Евсеев.

Бичулит \\ II. 33(аз)*; 85(аз)*

Бишофит \\ II. 142(е)*

Блатонит \\ II. 116(а)*

Блейкит \\ I. 58(а)*; II. 91(а)*

Блеклые руды \\ I. 65(аз)

Блёдит \\ I. 87(е)[?*]; 91(е); 205(а)!!; 220(е); 254(юа)*; II. 55(юа)*; 233(а)!!; 263(аз)!!--Пак. –xls<5 см;

“Бломстрандин” (= эшинит-(Y)) \\ II. 252(аф)Бобджонесит\ bobjonesite \\ U-V-вые рудники, района Темпл-Маунтин, Юта, США--Haynes P. et al., 2003; ЗВМО, 2004, №6, 33; назван в честь популяризатора минералогии Роберта (Боба) Джонса\ Robert (Bob) Jones
Бобджонесит\ bobjonesite \\ North Mesa Mine group*, San Rafael District ( San Rafael Swell), Emery Co ., Utah, USA \ U-V-вые рудники, района Темпл-Маунтин, Юта, США--Haynes P. et al., 2003; ЗВМО, 2004, №6, 33; назван в честь популяризатора минералогии Роберта (Боба) Джонса\ Robert (Bob) Jones (р.1926) \ Бобджонесит. Темпл-Маунтин, округ Эмери, Юта, США. Образец: ФМ (№92508. Дар. Pinch W. 2008).

Бобфергусонит \\ II. 62(а)*

Бобьерит \\ I. 28(е); 76(е)!!; 107(е)!!; II. 27(е); 158(юа)*; 246(юа); 274(ав)—Воджина \\ http://www.mindat.org/min-701.html--миндат 15 фото (все Ковдор)

Боггсит \\ II. 90(а)*

Богдановит \\ I. 10(аз)*

Бокит \\ I. 27(аз)*; II. 166(а) \\ Анкинович Е. А. Новый ванадиевый минерал - бокит // ЗВМО. 1963, ч. 92, вып. 1, с. 51-59.

Боксит \\ I. 114(е)

Болдыревит \\ I. 106(аз)*

Болеит \\ I. 18(а)*!!!; 38(а)*!!!; 251(аз); II. 17(а)*!!!; 37(а)*!!!; 218(юа)—Чили \\ Челекен, Туркмения

Боливарит \\ II. 129(аф)

Болтвудит \\ II. 20(аф)

Бонаттит \\ I. 55(е) \\ Авдонин В.Н. Бонаттит - новый сульфат меди в Гайском месторождении. - Тр. Минералогического музея АН СССР, 1978, №27, с. 5-9.
Бонаккордит \\ II. 38(аф)*; 225(аф)*;

“Бончевит”(смесь) \\ I. 153(е)

Бонштедтит \\ I. 54(е)*; 107(е)*

Бор \\ Grew, E.S., and Anovitz, L.M. (1996) BORON: Mineralogy, Petrology and Geochemistry, second edition, as revised (2002).

Бор_минералогия и геохимия

Боралсилит \\ II. 14(е)*; 240(ан)*

Бораты \\ Озол А.А. и др. Вулканогенно-осадочные бораты на Памире. - Сов. геол., 1975, №12, 142-143.

Борацит \\ I. 18(юа); 121(аз); 154(аз); 260(е); II. 148(е)*!!; 270(е); \\ Берлепш р-к, Штасфурт, Саксония-Анхальт \ Berlepsch Mine, Stassfurt , Stassfurt Potash deposit , Saxony-Anhalt , Germany

Борацит. Berlepsch, Саксония-[Анхальт], Германия. ~1 см. Образец: Мин. музей им.А.Е. Ферсмана РАН (№18921, Rieman C., 1911). Фото: © А.А. Евсеев.

Боришанскит \\ I. 162(аз)*; 214(аз)*

Боркарит \\ I. 205(аз)*

Борнеманит \\ I. 265(е)*

Борнит \\ I. 52(е); 54(е)!!; 68(аз)!!!; 122(аз); 136(аф); 142(е)!!; 181(е); 183(е); 196(аз); 228(е)!!; 232(аз); 238(е)!!; 238(е)!!; II. 36(аф); 84(е)!!; 157(е)!!--Ю. Тироль—xl 4, 5 см; 232(аф)!!--Зимб. –xl 5 см; 272(е)!;

Борнит !!! \\ Джезказган(ское) м-ние—145-5— xls < 3 см ; лучшие в мире xls ( MR , 1999, T . Moor ); ФМ (№87871, Степанов В.И.—сросток xls (2- 3 см ))

Борнхардтит \\ II. 254(е)*

Боровскит \\ I. 242(е)*

Бородаевит \\ I. 18(аз)*

Борокукеит\ borocookeite \\ Малханское м-ние, Забайкалье, Россия--Zagorsky V. et al., 2003; ЗВМО, 2004, №6, 43
Боромусковит \\ I. 129(а)*

Боромусковит-1М \\ II. 144(а)*

“Босфорит” \\ I. 268(е)

Боталлакит \\ II. 143(е); 235(е); 272(е)* \\ Джезказган, Казахстан@

Ботриоген \\ I. 234(е)*; II. 79(е)*

Боттиноит \\ II. 39(е)*

Брабантит \\ II. 39(аф)* \\ Пеков И.В. Висмутосодержащий брабантит из редкометальных пегматитов Липовки, Средний Урал. - Уральский геологический журнал, 2002, 5(29), 119-127.

Брадачекит\ bradaczekite \\ БТТИ, 1975-1976, Камчатка, Россия--Filatov S.K. et al., 2001; ЗВМО, 2002, №6, 28; Hans Bradaczek
Бразилианит \\ I. 55(юа)!!; 110(юа)!!!; 112(юа)!!!; 166(а); II. 26(юа)!!; 43(аф); 59(юа)!!!; 60(юа)!!!--xls<16 см; 67(юа)*; 86(юа)*!!!; 144(юа)!!; 157(юа)!!; 189(а)—Нью-Гэмпшир; 209(юа)* \\ Cook, Robert B. (2000) Brazilianite. Rocks & Minerals: January 2000.

Бразилианит - http://www.mindat.org/min-760.html \\ м-н-ний(44); фото (152) \\ 2009.08.04

Бразилианит. Минас-Жерайс, Бразилия. ~12 см. Образец: ФМ. Фото: © А.А. Евсеев.

Бракебушит \\ I. 48(юа)*; II. 60(юа)*; 139(юа); 264(юа)*--Арг. ;

Бракебушита, Fe-аналог* \\ Венус м-ние* \ Venus deposit, Sierra de Cordoba, Аргентина \\ Гурбанова О.А., Расцветаева Р.К., Чуканов Н.В.-Докл. РАН, 2001, 378 (2), 204-207

Брандтит \\ I. 233(аз) \\

Брандтит \\ Фалотта, Граубюнден, Швейцария - http://www.mindat.org/min-753.html \\ Geiger, T . (1948): Brandtit aus dem Oberhalbstein GR . Schweiz. Mineral. Petrogr. Mitt. 28, 468-474

Браннерит \\ I. 68(аз); II. 36(а); 73(е)!; 105(е); 124(а)*; 168(а)—Колорадо; 230(е)!!--Кордова; \\ Браннерит*-- \\ Айдахо* -- Hess, F.L. & R.C. Wells (1920), Brannerite, a new uranium mineralю - Franklin Institute Jour.: 225-237 & 779 + 780. \\ Самаркия \ Samarkiya area, Bhilwara Distr., Раджастан, Индия; 25°10` с. ш. , 74°28`30`` в. д.-- браннерит---Shagi T.S. et al., 2007 \\ Кристалл 11,5х 4х 3,5 см. Эль-Кабриль Орначуэлос, Кордова, Андалузия, Испания \ El Cabril, Hornachuelos, Cordoba, Andalucia, Spain. Образец: Joaquin Folch. Фото

Браунит \\ I. 39(аз); 68(аз); 83(е); 95(аз); 100(аз); 130(е); 158(аф)!!; 176(аз); 233(аз); II. 109(е); 175(аф)!!--Калахари; 251(аз)!!--Тироди, Индия—xl 3, 5 см;

Браунит-II \\ II. 35(аф)*

Брейтгауптит \\ II. 18(е)*; 57(а); II. 178(а)—(Кобальт)

Бренкит \\ II. 224(е)*

Бреннокит \\ I. 239(а)*

Бресуэлит \\ II. 158(юа)*

Бриартит \\ I. 104(аф); II. 127(аф)*; 201(аф)*

Бриартит. Кипуши, ДР Конго. Образец: Минер. музей им. А.Е. Ферсмана РАН (ST7797. Обмен. Национальный музей Болгарии, 1976). Фото: © А.А. Евсеев \\ Кат--КонгоД --33_19

Бриндлейит \\ II. 153(е)*

Бринробертсит\ brinrobersite \\ Бангор р-н, Сев. Уэльс, Великобритания--Dong H. et al., 2002; ЗВМО, 2004, №6, 44

Бритвинит* \\ Чуканов Н.В., Якубович О.В., Пеков И.В., Белаковский Д.И., Масса В. Бритвинит Pb15Mg9(Si10O28)(BO3)4(CO3)2(OH)12O2-новый минерал из Лонгбана, Швеция. - ЗРМО, 2007, ч. 136, в.6, с.18-25.

Бритолит \\ I. 43(аз)!!!; 87(аз); 105(аз); 206(аз); 221(а)

Бритолит-(Ce) \\ I. 147(е); II. 175(а)*

Бритолит-(Y) \\ I. 10(аз)*; 74(е); 179(е); 183(е); II. 9(аз)*

Бродткорбит \ brodtkorbite - http://www.mindat.org/min-7090.html \\ Сьерра-де-Уманго, Ла-Риоха, Аргентина - http://www.mindat.org /loc-55.html \\

Бромаргирит (бромирит) \\ II. 198(а)

Бромеллит \\ I. 82(е)!!; 130(е)*; 173(е); II. 138—Лонгбан; \\ Larsen, A. O., Asheim, A. & Berge, S. A. 1987: Bromellite from syenite pegmatite, southern Oslo Region, Norway. Canadian Mineralogist, 25, 425-428 \\ Аркия м-ние, бл. Нерчинска, Чит. обл.--Bern-04

Бромирит \\ II. 52(юа)

Бронзит \\ II. 172(аз)

Брошантит \\ I. 14(аз); 35(а); 41(ав); 42(аф); 62(е); 141(е)*; 254(аз); II. 11(аф)!!; 158(а)!!

Брукит \\ I. 24(е)!!; 41(е)!!; 71(е)!!; 80(аз); 133(а)!!!; 150(аз)!!; 154(е)!!; 178(е)*; 185(е)!!; 190(е)!!; 222(е)!!; 227(аз); II. 39(е)!!; 84(е)!; 150(а)!!--Арканзас; 171(аз)!!--Мурун; 197(е)!!; 201(е)[*]—Уэльс; 209(е)!!; 216(е)!!--Валлис; 253(е)!!--Уэльс; \\ Grossmann, M. (2004): Ein interessanter Neufund von Brookite aus Baluchistan, Pakistan. - Mineralien Welt 15 (6), 58-61 \\ Харан \ Kharan, Пакистан-- брукит!!! \ http://www.mindat.org/loc-56008.html ; фото - http://www.mindat.org/gallery.php?cform_is_valid=1&loc=56008&cf_pager_page=2

“Брункит” (= сфалерит) \\ I. 223(е)

Бруньятеллит \\ II. 48(е); 262(е)*

Брусит \\ I. 13(аз); 24(а); 26(е)!!; 30(е); 53(а)!!; 68(а); 71(аз)!!; 81(аз); 101(е)!!; 109(аз)!!; 118(аз); 144(аз)!!; 145(аз)!!!; 169(е); 195(е); 244(а)*; 259(аз); 265(аф)!!; II. 77(аф)!; 103(а)*; 275(а)!!--Пенс. ;

Брушит \\ I. 63(аз); 195(аз); II. 24(ао)(юа)*

Брэггит \\ I. 177(аф)*; II. 200(аф)*--Бушвелд; 282(аф)

Брюстерит \\ \\ I. 209(е)*; II. 241(е)*; 273(е)*

Буаззерит \\ Meisser N., Brugger J. Bouazzerit und Maghrebit, zwei neue Arsenatmineralien aus dem Revier Bou Azzer, Marokko. - Lapis, 2006, 31(7/8), 69-71

Букет цветов из самоцветов_ Музей ест. истории, Вена \\ фото - http://www.nhm-wien.ac.at/nhm/mineral/pic/08E-Strauss05.htm \\ 761 variegated stones and 2,102 diamonds were used in the assembly of this bouquet of jewels - representing a bouquet of flowers, along with diverse artistically reproduced insects, leaves of silk, contained in a vase of rock crystal. Maria Theresia is said to have put this bouquet in the Emperor's Mineral Cabinet one spring morning (FITZINGER, 1856).

Буклеты, минералогические - проект А.А. Бочарова

Буковит \\ II. 42(е)*

Буковскиит \\ I. 94(е)*

Буланжерит. Николаевский р-к, Дальнегорск, Приморье, Россия. 35 мм. Образец и фото: © В. Пономаренко

Буланжерит\\ I. 11(аз); 15(аз); 46(аз); 62(аз); 75(е); 222(е); II. 169(ав)!!--вкл. в кварце; 215(е)!!--Франция; \\ Паталаха Г.Б. Менегинит и буланжерит в рудах Pb-Zn-вых м-ний Текелийской группы. - ЗВМО, 1986, 115, №1, 72-78 \\ Казахстан--фото --Н. Колтовой

Бултфонтейнит \\ I. 45(аф)*; II. 43(юа)*; 85(аз); 270(аф)!! \\ Шабынин Л.И., Борисовский С.Е., Басова Г.В. О бультфонтейните и скоутите в скарнах Центрального Кансая (Юго-Западный Карамазар) // ДАН СССР. - 1983. - Т. 270. - № 4.

Бунзенит \\ I. 85(е)*; II. 116(е)*

Бура \\ I. 40(а)!!!; 188(аз)!!; 216(аз); 218(аз); 267(а)!!!; II. 38(а)!!; 38(а)!!!--xls<31 см; 213(аз)*; II. 43(аз); 128(аз); 136(аз)*

Бурангаит \\ I. 245(е); II. 43(аф)*; 98(е)

Бурбанкит (= бербанкит) \ burbankite \\ I. 22(аз); 199(а)!!; II. 30(а); 33(а)*; 170(а)—Сент-Илер—д. к. ;

Буркхардтит \\ II. 135(а)*; 162(а)*

Бурнонит \\ I. 17(е); 30(е); 30(е)!!; 46(е)!!; 52(е)!!; 57(е); 65(аз)!!; 89(е)!!; 95(аз); 110(а); 128(е)!!; 157(е)!!; 212(е)!!; 228(е)*; 243(е)!!; 268(аз)!!; II. 49(а)!!; 98(е)!!; 101(е)!!!--xls<11 см; II. 106(юа)!!; 162(е)!!--Ирл. ; 169(ав)!!; 176(е)!!--Гарц; 191(а)!!--Юта; 203(аз)!!; 211(е)!!; 272(е)*--Корн. ; 275(е)!!!--Вольфсберг; 276(аз)—Хунань—xls<8 см

Буроваит-Ca \\ Азарова Ю. В., Шлюкова З. Н., Золотарев А. А., мл., Органова Н. И. Буроваит -Ca, (Na,K)4Ca2·(Ti,Nb)8[Si4O12]4(OH,O)8·12H2O - новый минерал группы лабунцовита и его место в процессах низкотемпературного минералообразования в пегматитах Хибинского массива (Кольский полуостров, Россия). - Зап.РМО, 2009, ч.138, вып. 2, с. 40-52

Бурпалит* - Бурпала, Сев. Прибайкалье, Россия \\ I. 43(аз)* \\ Merlino S., Perchiazzi N., Khomyakov A.P., Pushcharovsky D.Y., Kulikova I.M., Kuzmin V.I.(1990): Burpalite, a new mineral from Burpalinskii massif, north Transbajkal, USSR: its crystal structure and OD character. Eur. J. Mineral., 2, 177-185. ; HB2/1 (1995); NM 90-94 (1997)

Бурсаит \\ II. 258(аз)*

Буртит \\ II. 73(аф)*

Бурятит\ buryatite \\ Солонго, Бурятия--Малинко С.В. и др.; ЗВМО, 2002, №6, 26
Буссенготит \\ II. 253(е)*

Буссенит\ bussenite \\ Кукисвумчорр, Хибинский м-в, Кольский п-ов, Россия; отвалы Кировского подземного р-ка--Хомяков А.П. и др., 2001; ЗВМО, 2002, №6, 32
Бустамит \\ I. 41(ав)!!; 71(аз); 74(е); 219(а)*; II. 41(ав)!; 248(а)*--Пуэбла

Бустамит. Брокен-Хилл, Н.Ю. Уэльс, Австралия. Образец: George Stacey Collection Тусон-шоу-2007). Фото: © В. Левицкий и М. Аносов.

Бутлерит \\ I. 267(а)*; II. 259(а)*

Буттгенбахит \\ I. 128(аф)*!!; II. 143(аф)*

Бушмакинит* \\Пеков И.В., Клейменов Д.А., Чуканов Н.В., Якубович О.В., Масса В., Белаковский Д.И., Паутов Л.А. Бушмакинит Pb2Al(PO4)(VO4)(OH) - новый минерал группы бракебушита из зоны окисления Березовского золоторудного месторождения, Средний Урал // ЗВМО, 2002, 131, 2, 62-71.

Быковаит* \\ Хомяков А. П., Меньшиков Ю. П., Феррарис Дж., Немет П., Нечелюстов Г. Н.
Быковаит, BaNa{(Na,Ti)4[(Ti,Nb)2(OH,O)3Si4O14](OH,F)2}·3H2O-новый гетерофиллосиликат из Ловозерского щелочного массива, Кольский полуостров. Россия. - Зап. РМО, 2005, ч.134, вып. 5, с. 40-48 \\ быковаит*--Шкатулка, Аллуайв - http://www.mindat.org/min-26447.html

Быстрит \\ I. 135(аз)*

Быстрит. Малобыстринское м-ние, ЮЗ Прибайкалье, Россия. Образец: Минер. музей им. А.Е. Ферсмана РАН (№89404. Поступление 1998 г.) . Фото: © А.А. Евсеев. \\ НМК-128 --33_13

Бьякеллаит \ biachellaite* - новый минерал из долины Бьякелла \ Val Biachella (3 км к ССЗ от Сакрофано, Лацио, Италия) \\ Чуканов Н. В., Расцветаева Р. К., Пеков И. В., Задов А. Е., Аллори Р., Зубкова Н. В., Гистер Г., Пущаровский Д. Ю., Ван К. В. Бьякеллаит (Na,Ca,K) 8(Si6Al6O24)(SO4)2(OH)0.5·H2O-новый минерал группы канкринита. - Зап. РМО, 2008, ч. 137, вып. 3, с.57-66

Бьярбиит \\ I. 166(а)*; II. 189(а)*

Бюргерит \\ I. 143(а)*; II. 158(а)*--Мекс.

 

А - Б - В - Г - Д - Е - Ж - З - И - К - Л - М - Н - О - П - Р - С - Т - У - Ф - Х - Ц - Ч - ШЩ - Э - Ю - Я

Начало страницы

СТРАНЫ от А до Я

находки минералов по листам карты мира: 1234567 891011121314151617181920212223242526272829303132 - 33

НЕ ТОЛЬКО МИНЕРАЛЫ:

А Б В Г Д Е Ж З ИЙ К Л М Н О П Р С Т У Ф Х Ц Ч ШЩ Э Ю Я

местонахождения минералов - | - mineral localities : А Б В ГДЕ Ж З И Й К Л М Н О ПР С Т У Ф Х Ц ЧШ Щ Э Ю Я || A B C D E F G H I J K L M N O P R S T U V W X Y Z
Сев. Америка (С)

Гренландия

Атлантика - Скандинавия - Кольский п-в

Урал
Ср. Сибирь
Якутия
СВ России

Сев. Америка (З - Сев. Америка (Кордильеры)

Сев. Америка (В)

Британ. о-ва, Пиренейский п-в - Зап. Европа - Вост. Европа

Казахстан, Ср. Азия

Юг Сибири
Забайкалье, Вост . Сибирь
Камчатка - Дальний Восток (Россия, Япония
Мексика
Кавказ, ЮЗ Азия
Афганистан, Пакистан
Индия
Монголия. Китай
ЮВ Азия - Тихий океан
Ю. Америка (СЗ) - Кордильеры
Бразилия

Африка - Сев. и Зап.Экв. и ЮжнВост.

Антарктида
Австралия

Тихий океан - Весь мир

янв
фев
март
апр
май
июнь
июль
авг
сен
окт
нояб
дек
2004
2005
2006
2007
2008
2009
2010
2011
2012
2013
№104 №112
2014 №114
2015
№126 №131
2016
№146
2017
         
обновление: 2017. 07. 06

© Александр Евсеев, 2003 - 2017. © Фото: принадлежит авторам, 2017